CAS 1513352-29-8 is the registry number for 6,8-difluoro-4-methyl-2H-chromen-2-one, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6,8-difluoro-4-methylchromen-2-one (CAS 1513352-29-8) is a chemical compound with the molecular formula C10H6F2O2 and a molecular weight of 196.15 g/mol. IUPAC name: 6,8-difluoro-4-methylchromen-2-one. InChIKey: IUFRDSNQJCPBTB-UHFFFAOYSA-N.
| Molecular formula | C10H6F2O2 |
|---|---|
| Molecular weight | 196.15 g/mol |
| IUPAC name | 6,8-difluoro-4-methylchromen-2-one |
| InChIKey | IUFRDSNQJCPBTB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=C(C=C2F)F |
Computed by PubChem (NCBI)