CAS 1486-65-3 appears in our catalog under these names: Kaempferol 3,5–dimethyl ether, Kaempferol 3,5-dimethyl ether. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
7-hydroxy-2-(4-hydroxyphenyl)-3,5-dimethoxychromen-4-one (CAS 1486-65-3) is a chemical compound with the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. IUPAC name: 7-hydroxy-2-(4-hydroxyphenyl)-3,5-dimethoxychromen-4-one. InChIKey: XMCNEMKKAQGVGK-UHFFFAOYSA-N.
| Molecular formula | C17H14O6 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | 7-hydroxy-2-(4-hydroxyphenyl)-3,5-dimethoxychromen-4-one |
| InChIKey | XMCNEMKKAQGVGK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1C(=O)C(=C(O2)C3=CC=C(C=C3)O)OC)O |
Computed by PubChem (NCBI)