Products 148674-34-4

CAS 148674-34-4 is the registry number for Eprosartan Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[[2-butyl-5-[(E)-2-carboxyethenyl]imidazol-1-yl]methyl]benzoic acid (CAS 148674-34-4) is a chemical compound with the molecular formula C18H20N2O4 and a molecular weight of 328.4 g/mol. IUPAC name: 4-[[2-butyl-5-[(E)-2-carboxyethenyl]imidazol-1-yl]methyl]benzoic acid. InChIKey: YOKNWHLCGXMWJI-MDZDMXLPSA-N.

Identity
Molecular formulaC18H20N2O4
Molecular weight328.4 g/mol
IUPAC name4-[[2-butyl-5-[(E)-2-carboxyethenyl]imidazol-1-yl]methyl]benzoic acid
InChIKeyYOKNWHLCGXMWJI-MDZDMXLPSA-N
SMILESCCCCC1=NC=C(N1CC2=CC=C(C=C2)C(=O)O)/C=C/C(=O)O

Computed by PubChem (NCBI)