CAS 160885-24-5 is the registry number for (S)-3-(Benzylamino)-2-(((benzyloxy)carbonyl)amino)propanoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-3-(benzylamino)-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 160885-24-5) is a chemical compound with the molecular formula C18H20N2O4 and a molecular weight of 328.4 g/mol. IUPAC name: (2S)-3-(benzylamino)-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: OAHOFSCUNXESMA-INIZCTEOSA-N.
| Molecular formula | C18H20N2O4 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | (2S)-3-(benzylamino)-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | OAHOFSCUNXESMA-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)CNC[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)