CAS 1640981-02-7 appears in our catalog under these names: (E)-4-(1-Benzyl-2-methyl-1H-imidazol-5-yl)-3-(ethoxycarbonyl)but-3-enoic acid, 98%, Tegoprazan Impurity 2, (E)-4-(1-Benzyl-2-methyl-1H-imidazol-5-yl)-3-(ethoxycarbonyl)but-3-enoic acid, 98%, 98%. Offered by: Chemat Brand, Chemat, Ambeed. Available pack sizes: on request, 250mg, 1g, 5g.
(E)-4-(3-benzyl-2-methylimidazol-4-yl)-3-ethoxycarbonylbut-3-enoic acid (CAS 1640981-02-7) is a chemical compound with the molecular formula C18H20N2O4 and a molecular weight of 328.4 g/mol. IUPAC name: (E)-4-(3-benzyl-2-methylimidazol-4-yl)-3-ethoxycarbonylbut-3-enoic acid. InChIKey: TVHFEMURPTYTGF-OQLLNIDSSA-N.
| Molecular formula | C18H20N2O4 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | (E)-4-(3-benzyl-2-methylimidazol-4-yl)-3-ethoxycarbonylbut-3-enoic acid |
| InChIKey | TVHFEMURPTYTGF-OQLLNIDSSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CN=C(N1CC2=CC=CC=C2)C)/CC(=O)O |
Computed by PubChem (NCBI)