CAS 88393-56-0 is the registry number for (+)-L-Tartaric acid dibenzyl amide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g.
(2R,3R)-N,N'-dibenzyl-2,3-dihydroxybutanediamide (CAS 88393-56-0) is a chemical compound with the molecular formula C18H20N2O4 and a molecular weight of 328.4 g/mol. IUPAC name: (2R,3R)-N,N'-dibenzyl-2,3-dihydroxybutanediamide. InChIKey: BBYSAHVLSFBCMN-HZPDHXFCSA-N.
| Molecular formula | C18H20N2O4 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | (2R,3R)-N,N'-dibenzyl-2,3-dihydroxybutanediamide |
| InChIKey | BBYSAHVLSFBCMN-HZPDHXFCSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)[C@@H]([C@H](C(=O)NCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)