CAS 148823-36-3 appears in our catalog under these names: H-D-Asp-OtBu, H–D–Asp–OtBu. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 2000mg, 1000mg.
(3R)-3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 148823-36-3) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: (3R)-3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: PUWCNJZIFKBDJQ-RXMQYKEDSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (3R)-3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | PUWCNJZIFKBDJQ-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)