CAS 149065-77-0 is the registry number for (S)–2–(thiophen–2–yl)–4–phenyl–4,5–dihydrooxazole. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
(4S)-4-phenyl-2-thiophen-2-yl-4,5-dihydro-1,3-oxazole (CAS 149065-77-0) is a chemical compound with the molecular formula C13H11NOS and a molecular weight of 229.30 g/mol. IUPAC name: (4S)-4-phenyl-2-thiophen-2-yl-4,5-dihydro-1,3-oxazole. InChIKey: BZXDHTYWKPOWQO-LLVKDONJSA-N.
| Molecular formula | C13H11NOS |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | (4S)-4-phenyl-2-thiophen-2-yl-4,5-dihydro-1,3-oxazole |
| InChIKey | BZXDHTYWKPOWQO-LLVKDONJSA-N |
| SMILES | C1[C@@H](N=C(O1)C2=CC=CS2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)