CAS 17583-15-2 is the registry number for 2-Phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-one. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-phenyl-5,6-dihydro-4H-1,3-benzothiazol-7-one (CAS 17583-15-2) is a chemical compound with the molecular formula C13H11NOS and a molecular weight of 229.30 g/mol. IUPAC name: 2-phenyl-5,6-dihydro-4H-1,3-benzothiazol-7-one. InChIKey: LDXLKSGOQIQGLG-UHFFFAOYSA-N.
| Molecular formula | C13H11NOS |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | 2-phenyl-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| InChIKey | LDXLKSGOQIQGLG-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)SC(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)