CAS 730971-69-4 appears in our catalog under these names: 3-Phenoxybenzenecarbothioamide, 95%, 3-Phenoxythiobenzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
3-phenoxybenzenecarbothioamide (CAS 730971-69-4) is a chemical compound with the molecular formula C13H11NOS and a molecular weight of 229.30 g/mol. IUPAC name: 3-phenoxybenzenecarbothioamide. InChIKey: QJBRRYKDCBBKTC-UHFFFAOYSA-N.
| Molecular formula | C13H11NOS |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | 3-phenoxybenzenecarbothioamide |
| InChIKey | QJBRRYKDCBBKTC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C(=S)N |
Computed by PubChem (NCBI)