CAS 338982-20-0 is the registry number for 2-(p-Tolylthio)nicotinaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-(4-methylphenyl)sulfanylpyridine-3-carbaldehyde (CAS 338982-20-0) is a chemical compound with the molecular formula C13H11NOS and a molecular weight of 229.30 g/mol. IUPAC name: 2-(4-methylphenyl)sulfanylpyridine-3-carbaldehyde. InChIKey: GBXIOMWDPVMNHG-UHFFFAOYSA-N.
| Molecular formula | C13H11NOS |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfanylpyridine-3-carbaldehyde |
| InChIKey | GBXIOMWDPVMNHG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)SC2=C(C=CC=N2)C=O |
Computed by PubChem (NCBI)