Products 14919-17-6

CAS 14919-17-6 is the registry number for Benzene-1,2,4,5-d4, 97 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

1,2,4,5-tetradeuteriobenzene (CAS 14919-17-6) is a chemical compound with the molecular formula C6H6 and a molecular weight of 82.14 g/mol. IUPAC name: 1,2,4,5-tetradeuteriobenzene. InChIKey: UHOVQNZJYSORNB-NMRLXUNGSA-N.

Identity
Molecular formulaC6H6
Molecular weight82.14 g/mol
IUPAC name1,2,4,5-tetradeuteriobenzene
InChIKeyUHOVQNZJYSORNB-NMRLXUNGSA-N
SMILES[2H]C1=CC(=C(C=C1[2H])[2H])[2H]

Computed by PubChem (NCBI)