CAS 14919-17-6 is the registry number for Benzene-1,2,4,5-d4, 97 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
1,2,4,5-tetradeuteriobenzene (CAS 14919-17-6) is a chemical compound with the molecular formula C6H6 and a molecular weight of 82.14 g/mol. IUPAC name: 1,2,4,5-tetradeuteriobenzene. InChIKey: UHOVQNZJYSORNB-NMRLXUNGSA-N.
| Molecular formula | C6H6 |
|---|---|
| Molecular weight | 82.14 g/mol |
| IUPAC name | 1,2,4,5-tetradeuteriobenzene |
| InChIKey | UHOVQNZJYSORNB-NMRLXUNGSA-N |
| SMILES | [2H]C1=CC(=C(C=C1[2H])[2H])[2H] |
Computed by PubChem (NCBI)