Products 19467-27-7
CAS 19467-27-7 is the registry number for Benzene-1,2,3-d3, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g.
1,2,3-trideuteriobenzene (CAS 19467-27-7) is a chemical compound with the molecular formula C6H6 and a molecular weight of 81.13 g/mol. IUPAC name: 1,2,3-trideuteriobenzene. InChIKey: UHOVQNZJYSORNB-CBYSEHNBSA-N.
| Molecular formula | C6H6 |
|---|---|
| Molecular weight | 81.13 g/mol |
| IUPAC name | 1,2,3-trideuteriobenzene |
| InChIKey | UHOVQNZJYSORNB-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=CC=C1)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
1,2,3-Trideuteriobenzene, Benzene-d3-2