CAS 32488-44-1 appears in our catalog under these names: Benzene-13C6, BENZENE-13C6, 99 ATOM % 13C. Offered by: TRC, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 500mg, 5G.
(1,2,3,4,5,6-13C6)cyclohexatriene (CAS 32488-44-1) is a chemical compound with the molecular formula C6H6 and a molecular weight of 84.068 g/mol. IUPAC name: (1,2,3,4,5,6-13C6)cyclohexatriene. InChIKey: UHOVQNZJYSORNB-IDEBNGHGSA-N.
| Molecular formula | C6H6 |
|---|---|
| Molecular weight | 84.068 g/mol |
| IUPAC name | (1,2,3,4,5,6-13C6)cyclohexatriene |
| InChIKey | UHOVQNZJYSORNB-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13CH][13CH]=[13CH]1 |
Computed by PubChem (NCBI)