CAS 14941-53-8 is the registry number for Benzene-1,2,4-d3, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g.
1,2,4-trideuteriobenzene (CAS 14941-53-8) is a chemical compound with the molecular formula C6H6 and a molecular weight of 81.13 g/mol. IUPAC name: 1,2,4-trideuteriobenzene. InChIKey: UHOVQNZJYSORNB-FYFKOAPZSA-N.
| Molecular formula | C6H6 |
|---|---|
| Molecular weight | 81.13 g/mol |
| IUPAC name | 1,2,4-trideuteriobenzene |
| InChIKey | UHOVQNZJYSORNB-FYFKOAPZSA-N |
| SMILES | [2H]C1=CC(=C(C=C1)[2H])[2H] |
Computed by PubChem (NCBI)