Products 14941-53-8

CAS 14941-53-8 is the registry number for Benzene-1,2,4-d3, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g.

Structural formula: {0} (CAS {1})

1,2,4-trideuteriobenzene (CAS 14941-53-8) is a chemical compound with the molecular formula C6H6 and a molecular weight of 81.13 g/mol. IUPAC name: 1,2,4-trideuteriobenzene. InChIKey: UHOVQNZJYSORNB-FYFKOAPZSA-N.

Identity
Molecular formulaC6H6
Molecular weight81.13 g/mol
IUPAC name1,2,4-trideuteriobenzene
InChIKeyUHOVQNZJYSORNB-FYFKOAPZSA-N
SMILES[2H]C1=CC(=C(C=C1)[2H])[2H]

Computed by PubChem (NCBI)