CAS 14919-49-4 appears in our catalog under these names: 4'-Hydroxyflavonol, 3-Hydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one, 98.33% ,, 98.33% ,, 3,4'-Dihydroxyflavone, 95%, 3,4'-Dihydroxyflavone/ 97.52% (existing batch purity), 3,4'-Dihydroxyflavone, >97.0%(GC). Offered by: Biosynth, Chemat, Combi-blocks, TargetMol, TCI. Available pack sizes: 10g, 25g, 200mg, 1g, 2mg, 5g, 250mg, 100mg.
3-hydroxy-2-(4-hydroxyphenyl)chromen-4-one (CAS 14919-49-4) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: 3-hydroxy-2-(4-hydroxyphenyl)chromen-4-one. InChIKey: GPGOCTLAUAHUQO-UHFFFAOYSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 3-hydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| InChIKey | GPGOCTLAUAHUQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=C(O2)C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)