CAS 149252-59-5 appears in our catalog under these names: trans-1-(tert-Butoxycarbonyl)-3-phenylpyrrolidine-2-carboxylic acid, 95%, Boc-trans-Pro(3-Ph)-OH (rac). Offered by: AmBeed, Iris Biotech. Available pack sizes: 1g, 250mg, 5g.
(2S,3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-phenylpyrrolidine-2-carboxylic acid (CAS 149252-59-5) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: (2S,3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-phenylpyrrolidine-2-carboxylic acid. InChIKey: LNVFMMJOXRYVKX-OLZOCXBDSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | (2S,3R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-phenylpyrrolidine-2-carboxylic acid |
| InChIKey | LNVFMMJOXRYVKX-OLZOCXBDSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@H]1C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)