CAS 462124-94-3 is the registry number for (2S,3S)–1–(tert–Butoxycarbonyl)–3–phenylpyrrolidine–2–carboxylic acid. Offered by: GLPBio. Available pack sizes: 1g.
(2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-phenylpyrrolidine-2-carboxylic acid (CAS 462124-94-3) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: (2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-phenylpyrrolidine-2-carboxylic acid. InChIKey: LNVFMMJOXRYVKX-STQMWFEESA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | (2S,3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-3-phenylpyrrolidine-2-carboxylic acid |
| InChIKey | LNVFMMJOXRYVKX-STQMWFEESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H]1C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)