CAS 149288-44-8 appears in our catalog under these names: 4-(4-Fluorophenoxymethyl)benzoic acid, 4-((4-Fluorophenoxy)methyl)benzoic acid 97%. Offered by: Biosynth, Ambeed. Available pack sizes: 0,5g, 5g, 100mg, 250mg, 1g.
4-[(4-fluorophenoxy)methyl]benzoic acid (CAS 149288-44-8) is a chemical compound with the molecular formula C14H11FO3 and a molecular weight of 246.23 g/mol. IUPAC name: 4-[(4-fluorophenoxy)methyl]benzoic acid. InChIKey: BXDPRCJDARSTDY-UHFFFAOYSA-N.
| Molecular formula | C14H11FO3 |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | 4-[(4-fluorophenoxy)methyl]benzoic acid |
| InChIKey | BXDPRCJDARSTDY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)