CAS 149353-84-4 appears in our catalog under these names: 4-(4'-Carboxyphenyl)piperidine hydrochloride, 98%, 4–(Piperidin–4–yl)benzoic acid hydrochloride, 4-(Piperidin-4-yl)benzoic acid hydrochloride, 4-(Piperidin-4-yl)benzoic acid hydrochloride, 98%, 4-(4-Piperidinyl)Benzoic Acid Hydrochloride (1:1), 98%, 98%. Offered by: Fluorochem, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 2g, 10g, 50mg.
4-piperidin-4-ylbenzoic acid;hydrochloride (CAS 149353-84-4) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: 4-piperidin-4-ylbenzoic acid;hydrochloride. InChIKey: VVWYZHFWAUQTKI-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | 4-piperidin-4-ylbenzoic acid;hydrochloride |
| InChIKey | VVWYZHFWAUQTKI-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)