CAS 1494088-89-9 appears in our catalog under these names: (1-(2,4-Difluorophenyl)-1H-pyrazol-3-yl)methanol, 95%, (1-(2,4-Difluorophenyl)-1H-pyrazol-3-yl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
[1-(2,4-difluorophenyl)pyrazol-3-yl]methanol (CAS 1494088-89-9) is a chemical compound with the molecular formula C10H8F2N2O and a molecular weight of 210.18 g/mol. IUPAC name: [1-(2,4-difluorophenyl)pyrazol-3-yl]methanol. InChIKey: WGUQIQVQCIDKEW-UHFFFAOYSA-N.
| Molecular formula | C10H8F2N2O |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | [1-(2,4-difluorophenyl)pyrazol-3-yl]methanol |
| InChIKey | WGUQIQVQCIDKEW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)N2C=CC(=N2)CO |
Computed by PubChem (NCBI)