Products 14941-51-6

CAS 14941-51-6 is the registry number for Benzene-1,3-d2, 97 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

1,3-dideuteriobenzene (CAS 14941-51-6) is a chemical compound with the molecular formula C6H6 and a molecular weight of 80.12 g/mol. IUPAC name: 1,3-dideuteriobenzene. InChIKey: UHOVQNZJYSORNB-DRSKVUCWSA-N.

Identity
Molecular formulaC6H6
Molecular weight80.12 g/mol
IUPAC name1,3-dideuteriobenzene
InChIKeyUHOVQNZJYSORNB-DRSKVUCWSA-N
SMILES[2H]C1=CC(=CC=C1)[2H]

Computed by PubChem (NCBI)