CAS 149506-05-8 appears in our catalog under these names: 3-(4-tert-Butoxycarbonylamino-phenyl)propionic acid, 95%, 3-(4-((tert-Butoxycarbonyl)amino)phenyl)propanoic acid, 97%, 4–(Boc–amino)benzenepropanoic Acid, 3-(Boc-4-aminophenyl)propionic acid, 4-[[(1,1-Dimethylethoxy)carbonyl]amino]benzenepropanoic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 10mg.
3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propanoic acid (CAS 149506-05-8) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propanoic acid. InChIKey: ZENOSLRCCHSZKU-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | 3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]propanoic acid |
| InChIKey | ZENOSLRCCHSZKU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)CCC(=O)O |
Computed by PubChem (NCBI)