Products 1495627-31-0
CAS 1495627-31-0 appears in our catalog under these names: 4-((3,5-Dimethylcyclohexyl)oxy)benzene-1-sulfonamide, 95%, 4-((3,5-Dimethylcyclohexyl)oxy)benzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(3,5-dimethylcyclohexyl)oxybenzenesulfonamide (CAS 1495627-31-0) is a chemical compound with the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. IUPAC name: 4-(3,5-dimethylcyclohexyl)oxybenzenesulfonamide. InChIKey: MYDZRBJNCOKOEZ-UHFFFAOYSA-N.
| Molecular formula | C14H21NO3S |
|---|---|
| Molecular weight | 283.39 g/mol |
| IUPAC name | 4-(3,5-dimethylcyclohexyl)oxybenzenesulfonamide |
| InChIKey | MYDZRBJNCOKOEZ-UHFFFAOYSA-N |
| SMILES | CC1CC(CC(C1)OC2=CC=C(C=C2)S(=O)(=O)N)C |
Computed by PubChem (NCBI)