CAS 1557220-99-1 appears in our catalog under these names: tert-Butyl 2-amino-5,7-dimethyl-4H,5H,7H-thieno(2,3-c)pyran-3-carboxylate, 95%, tert-Butyl 2-amino-5,7-dimethyl-4H,5H,7H-thieno(2,3-c)pyran-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 2-amino-5,7-dimethyl-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate (CAS 1557220-99-1) is a chemical compound with the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. IUPAC name: tert-butyl 2-amino-5,7-dimethyl-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate. InChIKey: IMCCETIHONKMDY-UHFFFAOYSA-N.
| Molecular formula | C14H21NO3S |
|---|---|
| Molecular weight | 283.39 g/mol |
| IUPAC name | tert-butyl 2-amino-5,7-dimethyl-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate |
| InChIKey | IMCCETIHONKMDY-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C(O1)C)SC(=C2C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)