Products 17358-65-5
CAS 17358-65-5 is the registry number for 1-tert-butylazetidin-3-yl 4-methylbenzene-1-sulfonate, 95%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
(1-tert-butylazetidin-3-yl) 4-methylbenzenesulfonate (CAS 17358-65-5) is a chemical compound with the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. IUPAC name: (1-tert-butylazetidin-3-yl) 4-methylbenzenesulfonate. InChIKey: OGMMGLKVYASIPU-UHFFFAOYSA-N.
| Molecular formula | C14H21NO3S |
|---|---|
| Molecular weight | 283.39 g/mol |
| IUPAC name | (1-tert-butylazetidin-3-yl) 4-methylbenzenesulfonate |
| InChIKey | OGMMGLKVYASIPU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CN(C2)C(C)(C)C |
Computed by PubChem (NCBI)