Products 1496288-69-7
CAS 1496288-69-7 appears in our catalog under these names: 5-(3,4,5-trifluorophenyl)-1,2-oxazol-3-amine, 98%, 98%, 5-(3,4,5-Trifluorophenyl)isoxazol-3-amine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
5-(3,4,5-trifluorophenyl)-1,2-oxazol-3-amine (CAS 1496288-69-7) is a chemical compound with the molecular formula C9H5F3N2O and a molecular weight of 214.14 g/mol. IUPAC name: 5-(3,4,5-trifluorophenyl)-1,2-oxazol-3-amine. InChIKey: MCCYATPUYQBSBM-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O |
|---|---|
| Molecular weight | 214.14 g/mol |
| IUPAC name | 5-(3,4,5-trifluorophenyl)-1,2-oxazol-3-amine |
| InChIKey | MCCYATPUYQBSBM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C2=CC(=NO2)N |
Computed by PubChem (NCBI)