Products 14965-09-4
CAS 14965-09-4 is the registry number for 5,7,4'-Trihydroxy-3,8-dimethoxyflavone. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,7-dihydroxy-2-(4-hydroxyphenyl)-3,8-dimethoxychromen-4-one (CAS 14965-09-4) is a chemical compound with the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. IUPAC name: 5,7-dihydroxy-2-(4-hydroxyphenyl)-3,8-dimethoxychromen-4-one. InChIKey: QEXFTGWTWYZALN-UHFFFAOYSA-N.
| Molecular formula | C17H14O7 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3,8-dimethoxychromen-4-one |
| InChIKey | QEXFTGWTWYZALN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C2=C1OC(=C(C2=O)OC)C3=CC=C(C=C3)O)O)O |
Computed by PubChem (NCBI)