CAS 1496511-56-8 is the registry number for 1-Isopropyl-1H-1,2,3-triazole-5-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3-propan-2-yltriazole-4-sulfonyl chloride (CAS 1496511-56-8) is a chemical compound with the molecular formula C5H8ClN3O2S and a molecular weight of 209.66 g/mol. IUPAC name: 3-propan-2-yltriazole-4-sulfonyl chloride. InChIKey: FILUCMHOSWEVIB-UHFFFAOYSA-N.
| Molecular formula | C5H8ClN3O2S |
|---|---|
| Molecular weight | 209.66 g/mol |
| IUPAC name | 3-propan-2-yltriazole-4-sulfonyl chloride |
| InChIKey | FILUCMHOSWEVIB-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=CN=N1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)