CAS 2137792-99-3 is the registry number for 2-Aminopyridine-4-sulfonamide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-aminopyridine-4-sulfonamide;hydrochloride (CAS 2137792-99-3) is a chemical compound with the molecular formula C5H8ClN3O2S and a molecular weight of 209.66 g/mol. IUPAC name: 2-aminopyridine-4-sulfonamide;hydrochloride. InChIKey: ZOQPNPUCTWCLQA-UHFFFAOYSA-N.
| Molecular formula | C5H8ClN3O2S |
|---|---|
| Molecular weight | 209.66 g/mol |
| IUPAC name | 2-aminopyridine-4-sulfonamide;hydrochloride |
| InChIKey | ZOQPNPUCTWCLQA-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1S(=O)(=O)N)N.Cl |
Computed by PubChem (NCBI)