CAS 769937-44-2 is the registry number for 5-Chloro-n,n-dimethyl-1h-pyrazole-1-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-chloro-N,N-dimethylpyrazole-1-sulfonamide (CAS 769937-44-2) is a chemical compound with the molecular formula C5H8ClN3O2S and a molecular weight of 209.66 g/mol. IUPAC name: 5-chloro-N,N-dimethylpyrazole-1-sulfonamide. InChIKey: MOZMBGDSGIJLIO-UHFFFAOYSA-N.
| Molecular formula | C5H8ClN3O2S |
|---|---|
| Molecular weight | 209.66 g/mol |
| IUPAC name | 5-chloro-N,N-dimethylpyrazole-1-sulfonamide |
| InChIKey | MOZMBGDSGIJLIO-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1C(=CC=N1)Cl |
Computed by PubChem (NCBI)