Products 2428478-70-8

CAS 2428478-70-8 is the registry number for 1-Isopropyl-1H-1,2,4-triazole-3-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-propan-2-yl-1,2,4-triazole-3-sulfonyl chloride (CAS 2428478-70-8) is a chemical compound with the molecular formula C5H8ClN3O2S and a molecular weight of 209.66 g/mol. IUPAC name: 1-propan-2-yl-1,2,4-triazole-3-sulfonyl chloride. InChIKey: FXIKQURPSMDEET-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8ClN3O2S
Molecular weight209.66 g/mol
IUPAC name1-propan-2-yl-1,2,4-triazole-3-sulfonyl chloride
InChIKeyFXIKQURPSMDEET-UHFFFAOYSA-N
SMILESCC(C)N1C=NC(=N1)S(=O)(=O)Cl

Computed by PubChem (NCBI)