CAS 2428478-70-8 is the registry number for 1-Isopropyl-1H-1,2,4-triazole-3-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-propan-2-yl-1,2,4-triazole-3-sulfonyl chloride (CAS 2428478-70-8) is a chemical compound with the molecular formula C5H8ClN3O2S and a molecular weight of 209.66 g/mol. IUPAC name: 1-propan-2-yl-1,2,4-triazole-3-sulfonyl chloride. InChIKey: FXIKQURPSMDEET-UHFFFAOYSA-N.
| Molecular formula | C5H8ClN3O2S |
|---|---|
| Molecular weight | 209.66 g/mol |
| IUPAC name | 1-propan-2-yl-1,2,4-triazole-3-sulfonyl chloride |
| InChIKey | FXIKQURPSMDEET-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=NC(=N1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)