CAS 149690-12-0 appears in our catalog under these names: (2R,4S)-Ethyl 5-([1,1'-biphenyl]-4-yl)-4-amino-2-methylpentanoate hydrochloride, 98%, Sacubitril Impurity 9 HCl, N-des-succinyl-Sacubitril hydrochloride, >95% (HPLC), (2R,4S)–4–Amino–5–(biphenyl–4–yl)–2–methylpentanoi c acid ethyl ester hydrochloride, (2R,4S)-4-Amino-5-(biphenyl-4-yl)-2-methylpentanoic acid ethyl ester hydrochloride. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 25g, 1g, 100g, 5g, 10g, on request, 50mg, 50g.
Ethyl (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate;hydrochloride (CAS 149690-12-0) is a chemical compound with the molecular formula C20H26ClNO2 and a molecular weight of 347.9 g/mol. IUPAC name: ethyl (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate;hydrochloride. InChIKey: MYJTZLYRAWUSLB-WSCVZUBPSA-N.
| Molecular formula | C20H26ClNO2 |
|---|---|
| Molecular weight | 347.9 g/mol |
| IUPAC name | ethyl (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate;hydrochloride |
| InChIKey | MYJTZLYRAWUSLB-WSCVZUBPSA-N |
| SMILES | CCOC(=O)[C@H](C)C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)