CAS 2101223-17-8 is the registry number for Sacubitril Impurity 44 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2R,4R)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate;hydrochloride (CAS 2101223-17-8) is a chemical compound with the molecular formula C20H26ClNO2 and a molecular weight of 347.9 g/mol. IUPAC name: ethyl (2R,4R)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate;hydrochloride. InChIKey: MYJTZLYRAWUSLB-AEFICSSHSA-N.
| Molecular formula | C20H26ClNO2 |
|---|---|
| Molecular weight | 347.9 g/mol |
| IUPAC name | ethyl (2R,4R)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate;hydrochloride |
| InChIKey | MYJTZLYRAWUSLB-AEFICSSHSA-N |
| SMILES | CCOC(=O)[C@H](C)C[C@H](CC1=CC=C(C=C1)C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)