Products 56222-04-9
CAS 56222-04-9 appears in our catalog under these names: Femoxetine hydrochloride/ 99.48% (existing batch purity), Femoxetine Hydrochloride, Femoxetine (hydrochloride). Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
(3R,4S)-3-[(4-methoxyphenoxy)methyl]-1-methyl-4-phenylpiperidine;hydrochloride (CAS 56222-04-9) is a chemical compound with the molecular formula C20H26ClNO2 and a molecular weight of 347.9 g/mol. IUPAC name: (3R,4S)-3-[(4-methoxyphenoxy)methyl]-1-methyl-4-phenylpiperidine;hydrochloride. InChIKey: ORJNLCKHRRUOMU-OGPPPPIKSA-N.
| Molecular formula | C20H26ClNO2 |
|---|---|
| Molecular weight | 347.9 g/mol |
| IUPAC name | (3R,4S)-3-[(4-methoxyphenoxy)methyl]-1-methyl-4-phenylpiperidine;hydrochloride |
| InChIKey | ORJNLCKHRRUOMU-OGPPPPIKSA-N |
| SMILES | CN1CC[C@@H]([C@H](C1)COC2=CC=C(C=C2)OC)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)