CAS 2259707-96-3 appears in our catalog under these names: Sacubitril Impurity 45 HCl, Valsartan Impurity 61, Valsartan Impurity 85, Ethyl (2S,4R)-5-((1,1'-biphenyl)-4-yl)-4-amino-2-methylpentanoate hydrochloride, 98%, (2S,4R)-Ethyl 5-([1,1'-biphenyl]-4-yl)-4-amino-2-methylpentanoate (hydrochloride), 98%, 98%. Offered by: Chemat Brand, AmBeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: on request, 10mg, 25mg, 100mg, 10 mg, 50 mg, 100 mg, 25 mg.
Ethyl (2S,4R)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate;hydrochloride (CAS 2259707-96-3) is a chemical compound with the molecular formula C20H26ClNO2 and a molecular weight of 347.9 g/mol. IUPAC name: ethyl (2S,4R)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate;hydrochloride. InChIKey: MYJTZLYRAWUSLB-WRRDZZDISA-N.
| Molecular formula | C20H26ClNO2 |
|---|---|
| Molecular weight | 347.9 g/mol |
| IUPAC name | ethyl (2S,4R)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate;hydrochloride |
| InChIKey | MYJTZLYRAWUSLB-WRRDZZDISA-N |
| SMILES | CCOC(=O)[C@@H](C)C[C@H](CC1=CC=C(C=C1)C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)