Products 1497-18-3
CAS 1497-18-3 is the registry number for 3-(4-Chlorophenyl)-3-methylpyrrolidine-2,5-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(4-chlorophenyl)-3-methylpyrrolidine-2,5-dione (CAS 1497-18-3) is a chemical compound with the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. IUPAC name: 3-(4-chlorophenyl)-3-methylpyrrolidine-2,5-dione. InChIKey: UUGLTVQGULWIPD-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-3-methylpyrrolidine-2,5-dione |
| InChIKey | UUGLTVQGULWIPD-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)NC1=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)