Products 1497119-60-4

CAS 1497119-60-4 is the registry number for 2-(2-Methyl-1,3-thiazol-4-yl)-2-oxoacetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(2-methyl-1,3-thiazol-4-yl)-2-oxoacetic acid (CAS 1497119-60-4) is a chemical compound with the molecular formula C6H5NO3S and a molecular weight of 171.18 g/mol. IUPAC name: 2-(2-methyl-1,3-thiazol-4-yl)-2-oxoacetic acid. InChIKey: MEIHQZPKHPXGDV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5NO3S
Molecular weight171.18 g/mol
IUPAC name2-(2-methyl-1,3-thiazol-4-yl)-2-oxoacetic acid
InChIKeyMEIHQZPKHPXGDV-UHFFFAOYSA-N
SMILESCC1=NC(=CS1)C(=O)C(=O)O

Computed by PubChem (NCBI)