Products 1497974-80-7
CAS 1497974-80-7 is the registry number for 3,3-Dimethyl-2-(2-methylthiazole-4-carboxamido)butanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,3-dimethyl-2-[(2-methyl-1,3-thiazole-4-carbonyl)amino]butanoic acid (CAS 1497974-80-7) is a chemical compound with the molecular formula C11H16N2O3S and a molecular weight of 256.32 g/mol. IUPAC name: 3,3-dimethyl-2-[(2-methyl-1,3-thiazole-4-carbonyl)amino]butanoic acid. InChIKey: DURNKAIPIAXLJO-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O3S |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | 3,3-dimethyl-2-[(2-methyl-1,3-thiazole-4-carbonyl)amino]butanoic acid |
| InChIKey | DURNKAIPIAXLJO-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C(=O)NC(C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)