CAS 1499641-49-4 is the registry number for 3-Methyl-2-(2-methyl-1,3-thiazol-5-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-methyl-2-(2-methyl-1,3-thiazol-5-yl)butanoic acid (CAS 1499641-49-4) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: 3-methyl-2-(2-methyl-1,3-thiazol-5-yl)butanoic acid. InChIKey: KVZJWHKQHUZHLD-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | 3-methyl-2-(2-methyl-1,3-thiazol-5-yl)butanoic acid |
| InChIKey | KVZJWHKQHUZHLD-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(S1)C(C(C)C)C(=O)O |
Computed by PubChem (NCBI)