Products 1499641-49-4

CAS 1499641-49-4 is the registry number for 3-Methyl-2-(2-methyl-1,3-thiazol-5-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-methyl-2-(2-methyl-1,3-thiazol-5-yl)butanoic acid (CAS 1499641-49-4) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: 3-methyl-2-(2-methyl-1,3-thiazol-5-yl)butanoic acid. InChIKey: KVZJWHKQHUZHLD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13NO2S
Molecular weight199.27 g/mol
IUPAC name3-methyl-2-(2-methyl-1,3-thiazol-5-yl)butanoic acid
InChIKeyKVZJWHKQHUZHLD-UHFFFAOYSA-N
SMILESCC1=NC=C(S1)C(C(C)C)C(=O)O

Computed by PubChem (NCBI)