CAS 1499713-88-0 is the registry number for 2-(Oxolan-2-yl)-1,3-benzoxazole-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(oxolan-2-yl)-1,3-benzoxazole-6-carboxylic acid (CAS 1499713-88-0) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 2-(oxolan-2-yl)-1,3-benzoxazole-6-carboxylic acid. InChIKey: SJYUMPRIQBUORV-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 2-(oxolan-2-yl)-1,3-benzoxazole-6-carboxylic acid |
| InChIKey | SJYUMPRIQBUORV-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)C2=NC3=C(O2)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)