Products 1500083-83-9

CAS 1500083-83-9 is the registry number for 3-(4-Bromo-3-methylphenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(4-bromo-3-methylphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1500083-83-9) is a chemical compound with the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. IUPAC name: 3-(4-bromo-3-methylphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: VWFDJSNVLQFFLQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10BrNO3
Molecular weight296.12 g/mol
IUPAC name3-(4-bromo-3-methylphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid
InChIKeyVWFDJSNVLQFFLQ-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)C2=NOC(=C2C(=O)O)C)Br

Computed by PubChem (NCBI)