Products 1500083-83-9
CAS 1500083-83-9 is the registry number for 3-(4-Bromo-3-methylphenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-bromo-3-methylphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1500083-83-9) is a chemical compound with the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. IUPAC name: 3-(4-bromo-3-methylphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: VWFDJSNVLQFFLQ-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO3 |
|---|---|
| Molecular weight | 296.12 g/mol |
| IUPAC name | 3-(4-bromo-3-methylphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | VWFDJSNVLQFFLQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=NOC(=C2C(=O)O)C)Br |
Computed by PubChem (NCBI)