CAS 150057-97-9 appears in our catalog under these names: 4-(1-Pyrrolidinylcarbonyl)benzoic acid, 95-<97%, 4-[(Pyrrolidin-1-yl)carbonyl]benzoic acid, 98%. Offered by: Hoffman Fine Chemicals, Combi-blocks. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 1g.
4-(pyrrolidine-1-carbonyl)benzoic acid (CAS 150057-97-9) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 4-(pyrrolidine-1-carbonyl)benzoic acid. InChIKey: RHWLIPUKNHPPJJ-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 4-(pyrrolidine-1-carbonyl)benzoic acid |
| InChIKey | RHWLIPUKNHPPJJ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)