CAS 150092-11-8 is the registry number for 5-(Benzyloxy)benzo[d][1,3]dioxole-2-thione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-phenylmethoxy-1,3-benzodioxole-2-thione (CAS 150092-11-8) is a chemical compound with the molecular formula C14H10O3S and a molecular weight of 258.29 g/mol. IUPAC name: 5-phenylmethoxy-1,3-benzodioxole-2-thione. InChIKey: UZKVKYJLJVQTHL-UHFFFAOYSA-N.
| Molecular formula | C14H10O3S |
|---|---|
| Molecular weight | 258.29 g/mol |
| IUPAC name | 5-phenylmethoxy-1,3-benzodioxole-2-thione |
| InChIKey | UZKVKYJLJVQTHL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)OC(=S)O3 |
Computed by PubChem (NCBI)