CAS 414861-41-9 appears in our catalog under these names: Raloxifene Impurity 23, Raloxifene Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
4-(6-hydroxy-1-benzothiophen-2-yl)benzene-1,2-diol (CAS 414861-41-9) is a chemical compound with the molecular formula C14H10O3S and a molecular weight of 258.29 g/mol. IUPAC name: 4-(6-hydroxy-1-benzothiophen-2-yl)benzene-1,2-diol. InChIKey: YOQBIOFOMPHWKI-UHFFFAOYSA-N.
| Molecular formula | C14H10O3S |
|---|---|
| Molecular weight | 258.29 g/mol |
| IUPAC name | 4-(6-hydroxy-1-benzothiophen-2-yl)benzene-1,2-diol |
| InChIKey | YOQBIOFOMPHWKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC3=C(S2)C=C(C=C3)O)O)O |
Computed by PubChem (NCBI)