Products 327078-57-9

CAS 327078-57-9 is the registry number for 5-Hydroxy-7-(4-methylphenyl)-2h-1,3-benzoxathiol-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

5-hydroxy-7-(4-methylphenyl)-1,3-benzoxathiol-2-one (CAS 327078-57-9) is a chemical compound with the molecular formula C14H10O3S and a molecular weight of 258.29 g/mol. IUPAC name: 5-hydroxy-7-(4-methylphenyl)-1,3-benzoxathiol-2-one. InChIKey: RUCVHWRDFXVMMU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10O3S
Molecular weight258.29 g/mol
IUPAC name5-hydroxy-7-(4-methylphenyl)-1,3-benzoxathiol-2-one
InChIKeyRUCVHWRDFXVMMU-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=C3C(=CC(=C2)O)SC(=O)O3

Computed by PubChem (NCBI)