CAS 327078-57-9 is the registry number for 5-Hydroxy-7-(4-methylphenyl)-2h-1,3-benzoxathiol-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-hydroxy-7-(4-methylphenyl)-1,3-benzoxathiol-2-one (CAS 327078-57-9) is a chemical compound with the molecular formula C14H10O3S and a molecular weight of 258.29 g/mol. IUPAC name: 5-hydroxy-7-(4-methylphenyl)-1,3-benzoxathiol-2-one. InChIKey: RUCVHWRDFXVMMU-UHFFFAOYSA-N.
| Molecular formula | C14H10O3S |
|---|---|
| Molecular weight | 258.29 g/mol |
| IUPAC name | 5-hydroxy-7-(4-methylphenyl)-1,3-benzoxathiol-2-one |
| InChIKey | RUCVHWRDFXVMMU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C3C(=CC(=C2)O)SC(=O)O3 |
Computed by PubChem (NCBI)