CAS 2651958-73-3 is the registry number for (E)-4-(3-Oxo-3-(thiophen-2-yl)prop-1-en-1-yl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]benzoic acid (CAS 2651958-73-3) is a chemical compound with the molecular formula C14H10O3S and a molecular weight of 258.29 g/mol. IUPAC name: 4-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]benzoic acid. InChIKey: CPQNUADZNDUZRB-VMPITWQZSA-N.
| Molecular formula | C14H10O3S |
|---|---|
| Molecular weight | 258.29 g/mol |
| IUPAC name | 4-[(E)-3-oxo-3-thiophen-2-ylprop-1-enyl]benzoic acid |
| InChIKey | CPQNUADZNDUZRB-VMPITWQZSA-N |
| SMILES | C1=CSC(=C1)C(=O)/C=C/C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)