CAS 1500989-33-2 is the registry number for 8-Chloro-6-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-6-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid (CAS 1500989-33-2) is a chemical compound with the molecular formula C10H9ClFNO2 and a molecular weight of 229.63 g/mol. IUPAC name: 8-chloro-6-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid. InChIKey: RWCZGDHZKNSPFF-UHFFFAOYSA-N.
| Molecular formula | C10H9ClFNO2 |
|---|---|
| Molecular weight | 229.63 g/mol |
| IUPAC name | 8-chloro-6-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid |
| InChIKey | RWCZGDHZKNSPFF-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C1C(=O)O)C=C(C=C2Cl)F |
Computed by PubChem (NCBI)