Products 2781127-95-3
CAS 2781127-95-3 is the registry number for Methyl (E)-3-(6-amino-3-chloro-2-fluorophenyl)acrylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (E)-3-(6-amino-3-chloro-2-fluorophenyl)prop-2-enoate (CAS 2781127-95-3) is a chemical compound with the molecular formula C10H9ClFNO2 and a molecular weight of 229.63 g/mol. IUPAC name: methyl (E)-3-(6-amino-3-chloro-2-fluorophenyl)prop-2-enoate. InChIKey: JFVUUWDCNUSPMN-GORDUTHDSA-N.
| Molecular formula | C10H9ClFNO2 |
|---|---|
| Molecular weight | 229.63 g/mol |
| IUPAC name | methyl (E)-3-(6-amino-3-chloro-2-fluorophenyl)prop-2-enoate |
| InChIKey | JFVUUWDCNUSPMN-GORDUTHDSA-N |
| SMILES | COC(=O)/C=C/C1=C(C=CC(=C1F)Cl)N |
Computed by PubChem (NCBI)