CAS 2826175-37-3 is the registry number for 6-Chloro-7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid (CAS 2826175-37-3) is a chemical compound with the molecular formula C10H9ClFNO2 and a molecular weight of 229.63 g/mol. IUPAC name: 6-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid. InChIKey: WORUCIZALZUOFI-UHFFFAOYSA-N.
| Molecular formula | C10H9ClFNO2 |
|---|---|
| Molecular weight | 229.63 g/mol |
| IUPAC name | 6-chloro-7-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid |
| InChIKey | WORUCIZALZUOFI-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC(=C(C=C2C1C(=O)O)Cl)F |
Computed by PubChem (NCBI)